C25H33N3O4S — CID 132615646
N-cyclopentyl-2-[[2-(N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]propanamide (PubChem CID 132615646) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]propanamide.
| Compound Name | N-cyclopentyl-2-[[2-(N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 132615646 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-cyclopentyl-2-[[2-(N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]propanamide |
| SMILES | CC(C(=O)NC1CCCC1)N(CCc1ccccc1)C(=O)CN(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H33N3O4S/c1-20(25(30)26-22-13-9-10-14-22)27(18-17-21-11-5-3-6-12-21)24(29)19-28(33(2,31)32)23-15-7-4-8-16-23/h3-8,11-12,15-16,20,22H,9-10,13-14,17-19H2,1-2H3,(H,26,30) |
| InChIKey | PUHVUOVTYYUOME-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |