C26H34IN3O4S — CID 132637530
N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]propanamide (PubChem CID 132637530) has the molecular formula C26H34IN3O4S and a molecular weight of 611.55 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]propanamide.
| Compound Name | N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 132637530 |
| Molecular Formula | C26H34IN3O4S |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 611.13 |
| IUPAC Name | N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]propanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H34IN3O4S/c1-20(26(32)28-23-11-7-4-8-12-23)29(18-17-21-9-5-3-6-10-21)25(31)19-30(35(2,33)34)24-15-13-22(27)14-16-24/h3,5-6,9-10,13-16,20,23H,4,7-8,11-12,17-19H2,1-2H3,(H,28,32) |
| InChIKey | OOWKPJSHDXXEJT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|