C27H36IN3O4S — CID 132639961
N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide (PubChem CID 132639961) has the molecular formula C27H36IN3O4S and a molecular weight of 625.57 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide.
| Compound Name | N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132639961 |
| Molecular Formula | C27H36IN3O4S |
| Molecular Weight | 625.57 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C27H36IN3O4S/c1-3-25(27(33)29-23-12-8-5-9-13-23)30(19-18-21-10-6-4-7-11-21)26(32)20-31(36(2,34)35)24-16-14-22(28)15-17-24/h4,6-7,10-11,14-17,23,25H,3,5,8-9,12-13,18-20H2,1-2H3,(H,29,33) |
| InChIKey | IGWJJBUFFSUXMH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|