C28H31ClN2O3 — CID 132616615
4-(4-chlorophenoxy)-N-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]butanamide (PubChem CID 132616615) has the molecular formula C28H31ClN2O3 and a molecular weight of 479.02 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 132616615 |
| Molecular Formula | C28H31ClN2O3 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]butanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H31ClN2O3/c1-21-8-6-11-23(18-21)20-31(26(28(33)30-2)19-22-9-4-3-5-10-22)27(32)12-7-17-34-25-15-13-24(29)14-16-25/h3-6,8-11,13-16,18,26H,7,12,17,19-20H2,1-2H3,(H,30,33) |
| InChIKey | FFRCSQHGVKSEHA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|