C28H31ClN2O4 — CID 100706000
N-[(3-chlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[(2R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 100706000) has the molecular formula C28H31ClN2O4 and a molecular weight of 495.02 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[(2R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[(2R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 100706000 |
| Molecular Formula | C28H31ClN2O4 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[(2R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | CNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H31ClN2O4/c1-30-28(33)26(19-21-8-4-3-5-9-21)31(20-22-10-6-11-23(29)18-22)27(32)12-7-17-35-25-15-13-24(34-2)14-16-25/h3-6,8-11,13-16,18,26H,7,12,17,19-20H2,1-2H3,(H,30,33)/t26-/m1/s1 |
| InChIKey | CYXXSKMWRXUWOL-AREMUKBSSA-N |
| XLogP | 4.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|