C23H27ClFNO4 — CID 13261947
N-[4-[[(2R,6R)-6-[3-chloro-1-(4-fluorophenyl)propoxy]oxan-2-yl]methoxy]phenyl]acetamide (PubChem CID 13261947) has the molecular formula C23H27ClFNO4 and a molecular weight of 435.92 g/mol. Its IUPAC name is N-[4-[[(2R,6R)-6-[3-chloro-1-(4-fluorophenyl)propoxy]oxan-2-yl]methoxy]phenyl]acetamide.
| Compound Name | N-[4-[[(2R,6R)-6-[3-chloro-1-(4-fluorophenyl)propoxy]oxan-2-yl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 13261947 |
| Molecular Formula | C23H27ClFNO4 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[4-[[(2R,6R)-6-[3-chloro-1-(4-fluorophenyl)propoxy]oxan-2-yl]methoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OC[C@H]2CCC[C@H](OC(CCCl)c3ccc(F)cc3)O2)cc1 |
| InChI | InChI=1S/C23H27ClFNO4/c1-16(27)26-19-9-11-20(12-10-19)28-15-21-3-2-4-23(29-21)30-22(13-14-24)17-5-7-18(25)8-6-17/h5-12,21-23H,2-4,13-15H2,1H3,(H,26,27)/t21-,22?,23+/m1/s1 |
| InChIKey | HDCLSJXOGJZTRS-CTDXOEGXSA-N |
| XLogP | 5.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|