C29H35N3O4S — CID 132622346
2-[benzyl-[2-[methylsulfonyl(naphthalen-1-yl)amino]acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 132622346) has the molecular formula C29H35N3O4S and a molecular weight of 521.68 g/mol. Its IUPAC name is 2-[benzyl-[2-[methylsulfonyl(naphthalen-1-yl)amino]acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[benzyl-[2-[methylsulfonyl(naphthalen-1-yl)amino]acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 132622346 |
| Molecular Formula | C29H35N3O4S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 2-[benzyl-[2-[methylsulfonyl(naphthalen-1-yl)amino]acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1cccc2ccccc12)S(C)(=O)=O |
| InChI | InChI=1S/C29H35N3O4S/c1-22(29(34)30-25-16-7-4-8-17-25)31(20-23-12-5-3-6-13-23)28(33)21-32(37(2,35)36)27-19-11-15-24-14-9-10-18-26(24)27/h3,5-6,9-15,18-19,22,25H,4,7-8,16-17,20-21H2,1-2H3,(H,30,34) |
| InChIKey | FWVFQYFUNOTWPE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |