C28H29Cl2N3O4 — CID 132625676
2-[3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 132625676) has the molecular formula C28H29Cl2N3O4 and a molecular weight of 542.46 g/mol. Its IUPAC name is 2-[3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132625676 |
| Molecular Formula | C28H29Cl2N3O4 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 2-[3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C28H29Cl2N3O4/c1-31-26(35)24(15-18-7-3-2-4-8-18)33(17-19-11-12-20(29)16-23(19)30)25(34)13-14-32-27(36)21-9-5-6-10-22(21)28(32)37/h2-8,11-12,16,21-22,24H,9-10,13-15,17H2,1H3,(H,31,35)/t21-,22+,24? |
| InChIKey | XPHLDOSELKOHLD-RIKCKFAHSA-N |
| XLogP | 4.02 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|