C23H27Cl2N3O4 — CID 132944844
2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-ethylpropanamide (PubChem CID 132944844) has the molecular formula C23H27Cl2N3O4 and a molecular weight of 480.39 g/mol. Its IUPAC name is 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132944844 |
| Molecular Formula | C23H27Cl2N3O4 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1ccc(Cl)cc1Cl)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C23H27Cl2N3O4/c1-3-26-21(30)14(2)28(13-15-8-9-16(24)12-19(15)25)20(29)10-11-27-22(31)17-6-4-5-7-18(17)23(27)32/h4-5,8-9,12,14,17-18H,3,6-7,10-11,13H2,1-2H3,(H,26,30)/t14?,17-,18+ |
| InChIKey | XEOPOJBCEQXUPY-DODVFSASSA-N |
| XLogP | 3.19 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|