C25H30Cl2N4O6S — CID 132632906
N-cyclopentyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]butanamide (PubChem CID 132632906) has the molecular formula C25H30Cl2N4O6S and a molecular weight of 585.51 g/mol. Its IUPAC name is N-cyclopentyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]butanamide.
| Compound Name | N-cyclopentyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132632906 |
| Molecular Formula | C25H30Cl2N4O6S |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | N-cyclopentyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(C)(=O)=O |
| InChI | InChI=1S/C25H30Cl2N4O6S/c1-3-23(25(33)28-18-7-4-5-8-18)29(15-17-11-12-21(26)22(27)13-17)24(32)16-30(38(2,36)37)19-9-6-10-20(14-19)31(34)35/h6,9-14,18,23H,3-5,7-8,15-16H2,1-2H3,(H,28,33) |
| InChIKey | KGNMQVUCQUMOIF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|