C25H32Cl2N4O7S — CID 132636166
N-tert-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]butanamide (PubChem CID 132636166) has the molecular formula C25H32Cl2N4O7S and a molecular weight of 603.53 g/mol. Its IUPAC name is N-tert-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]butanamide.
| Compound Name | N-tert-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132636166 |
| Molecular Formula | C25H32Cl2N4O7S |
| Molecular Weight | 603.53 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | N-tert-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]butanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C25H32Cl2N4O7S/c1-7-20(24(33)28-25(2,3)4)29(14-17-18(26)9-8-10-19(17)27)23(32)15-30(39(6,36)37)21-13-16(31(34)35)11-12-22(21)38-5/h8-13,20H,7,14-15H2,1-6H3,(H,28,33) |
| InChIKey | CBYXIFZIRBRWJH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|