C24H30Cl2N4O7S — CID 132693949
2-[(3,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-propylbutanamide (PubChem CID 132693949) has the molecular formula C24H30Cl2N4O7S and a molecular weight of 589.50 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-propylbutanamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132693949 |
| Molecular Formula | C24H30Cl2N4O7S |
| Molecular Weight | 589.50 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C24H30Cl2N4O7S/c1-5-11-27-24(32)20(6-2)28(14-16-7-9-18(25)19(26)12-16)23(31)15-29(38(4,35)36)21-13-17(30(33)34)8-10-22(21)37-3/h7-10,12-13,20H,5-6,11,14-15H2,1-4H3,(H,27,32) |
| InChIKey | KEYBECIOIUZWQA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|