C21H24Cl2N4O7S — CID 132687404
2-[(3,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-methylpropanamide (PubChem CID 132687404) has the molecular formula C21H24Cl2N4O7S and a molecular weight of 547.42 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-methylpropanamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 132687404 |
| Molecular Formula | C21H24Cl2N4O7S |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C21H24Cl2N4O7S/c1-13(21(29)24-2)25(11-14-5-7-16(22)17(23)9-14)20(28)12-26(35(4,32)33)18-10-15(27(30)31)6-8-19(18)34-3/h5-10,13H,11-12H2,1-4H3,(H,24,29) |
| InChIKey | VOWWMTFBBAGZET-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|