C25H34N4O7S — CID 100633527
(2R)-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-(2-phenylethyl)amino]-N-propylbutanamide (PubChem CID 100633527) has the molecular formula C25H34N4O7S and a molecular weight of 534.64 g/mol. Its IUPAC name is (2R)-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-(2-phenylethyl)amino]-N-propylbutanamide.
| Compound Name | (2R)-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-(2-phenylethyl)amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100633527 |
| Molecular Formula | C25H34N4O7S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | (2R)-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-(2-phenylethyl)amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@@H](CC)N(CCc1ccccc1)C(=O)CN(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C25H34N4O7S/c1-5-15-26-25(31)21(6-2)27(16-14-19-10-8-7-9-11-19)24(30)18-28(37(4,34)35)22-17-20(29(32)33)12-13-23(22)36-3/h7-13,17,21H,5-6,14-16,18H2,1-4H3,(H,26,31)/t21-/m1/s1 |
| InChIKey | QEHRKYWLWSLFTO-OAQYLSRUSA-N |
| XLogP | 2.75 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|