C22H28N4O7S — CID 132678806
2-[benzyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-ethylpropanamide (PubChem CID 132678806) has the molecular formula C22H28N4O7S and a molecular weight of 492.55 g/mol. Its IUPAC name is 2-[benzyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[benzyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132678806 |
| Molecular Formula | C22H28N4O7S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-[benzyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1ccccc1)C(=O)CN(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C22H28N4O7S/c1-5-23-22(28)16(2)24(14-17-9-7-6-8-10-17)21(27)15-25(34(4,31)32)19-13-18(26(29)30)11-12-20(19)33-3/h6-13,16H,5,14-15H2,1-4H3,(H,23,28) |
| InChIKey | WTIHDHXJRDZXDB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|