C23H30N4O7S — CID 132680853
N-ethyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]propanamide (PubChem CID 132680853) has the molecular formula C23H30N4O7S and a molecular weight of 506.58 g/mol. Its IUPAC name is N-ethyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-ethyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132680853 |
| Molecular Formula | C23H30N4O7S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-ethyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]propanamide |
| SMILES | CCNC(=O)C(C)N(Cc1ccccc1C)C(=O)CN(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C23H30N4O7S/c1-6-24-23(29)17(3)25(14-18-10-8-7-9-16(18)2)22(28)15-26(35(5,32)33)20-13-19(27(30)31)11-12-21(20)34-4/h7-13,17H,6,14-15H2,1-5H3,(H,24,29) |
| InChIKey | RNMHFPVEFIMCHT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|