C24H32N4O7S — CID 132682924
2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-propan-2-ylpropanamide (PubChem CID 132682924) has the molecular formula C24H32N4O7S and a molecular weight of 520.61 g/mol. Its IUPAC name is 2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 132682924 |
| Molecular Formula | C24H32N4O7S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-propan-2-ylpropanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1ccccc1C)C(C)C(=O)NC(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C24H32N4O7S/c1-16(2)25-24(30)18(4)26(14-19-10-8-7-9-17(19)3)23(29)15-27(36(6,33)34)21-13-20(28(31)32)11-12-22(21)35-5/h7-13,16,18H,14-15H2,1-6H3,(H,25,30) |
| InChIKey | KYYURYDTTDEFNA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|