C25H34N4O6S — CID 132730637
2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-(2-phenylethyl)amino]-N-propan-2-ylbutanamide (PubChem CID 132730637) has the molecular formula C25H34N4O6S and a molecular weight of 518.64 g/mol. Its IUPAC name is 2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-(2-phenylethyl)amino]-N-propan-2-ylbutanamide.
| Compound Name | 2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-(2-phenylethyl)amino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 132730637 |
| Molecular Formula | C25H34N4O6S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-(2-phenylethyl)amino]-N-propan-2-ylbutanamide |
| SMILES | CCC(C(=O)NC(C)C)N(CCc1ccccc1)C(=O)CN(c1cc([N+](=O)[O-])ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C25H34N4O6S/c1-6-22(25(31)26-18(2)3)27(15-14-20-10-8-7-9-11-20)24(30)17-28(36(5,34)35)23-16-21(29(32)33)13-12-19(23)4/h7-13,16,18,22H,6,14-15,17H2,1-5H3,(H,26,31) |
| InChIKey | FQTHDRXXKGDKCW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|