C28H30Cl2N4O6S — CID 132639413
2-[(2,6-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-ethyl-3-phenylpropanamide (PubChem CID 132639413) has the molecular formula C28H30Cl2N4O6S and a molecular weight of 621.54 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-ethyl-3-phenylpropanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132639413 |
| Molecular Formula | C28H30Cl2N4O6S |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 620.13 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-ethyl-3-phenylpropanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc([N+](=O)[O-])ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C28H30Cl2N4O6S/c1-4-31-28(36)26(15-20-9-6-5-7-10-20)32(17-22-23(29)11-8-12-24(22)30)27(35)18-33(41(3,39)40)25-16-21(34(37)38)14-13-19(25)2/h5-14,16,26H,4,15,17-18H2,1-3H3,(H,31,36) |
| InChIKey | DKRFCMGGEQGCFV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|