C30H34Cl2N4O6S — CID 133174478
2-[(2,6-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide (PubChem CID 133174478) has the molecular formula C30H34Cl2N4O6S and a molecular weight of 649.60 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133174478 |
| Molecular Formula | C30H34Cl2N4O6S |
| Molecular Weight | 649.60 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1c(Cl)cccc1Cl)C(Cc1ccccc1)C(=O)NCC(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C30H34Cl2N4O6S/c1-20(2)17-33-30(38)28(15-22-9-6-5-7-10-22)34(18-24-25(31)11-8-12-26(24)32)29(37)19-35(43(4,41)42)27-16-23(36(39)40)14-13-21(27)3/h5-14,16,20,28H,15,17-19H2,1-4H3,(H,33,38) |
| InChIKey | BJKSZALBAYJCOH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|