C32H31ClN4O6S — CID 132641574
2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-chlorophenyl)methyl]amino]-N-ethyl-3-phenylpropanamide (PubChem CID 132641574) has the molecular formula C32H31ClN4O6S and a molecular weight of 635.14 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-chlorophenyl)methyl]amino]-N-ethyl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-chlorophenyl)methyl]amino]-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132641574 |
| Molecular Formula | C32H31ClN4O6S |
| Molecular Weight | 635.14 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-chlorophenyl)methyl]amino]-N-ethyl-3-phenylpropanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H31ClN4O6S/c1-2-34-32(39)30(21-24-9-5-3-6-10-24)35(22-25-13-15-26(33)16-14-25)31(38)23-36(27-17-19-28(20-18-27)37(40)41)44(42,43)29-11-7-4-8-12-29/h3-20,30H,2,21-23H2,1H3,(H,34,39) |
| InChIKey | LNOWILHVDUCJTH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.14 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|