C34H34Cl2N4O6S — CID 133173977
2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide (PubChem CID 133173977) has the molecular formula C34H34Cl2N4O6S and a molecular weight of 697.64 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133173977 |
| Molecular Formula | C34H34Cl2N4O6S |
| Molecular Weight | 697.64 g/mol |
| Exact Mass | 696.16 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
| SMILES | CC(C)CNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H34Cl2N4O6S/c1-24(2)21-37-34(42)32(20-25-9-5-3-6-10-25)38(22-26-13-18-30(35)31(36)19-26)33(41)23-39(27-14-16-28(17-15-27)40(43)44)47(45,46)29-11-7-4-8-12-29/h3-19,24,32H,20-23H2,1-2H3,(H,37,42) |
| InChIKey | XDIIFXXDWFJYOJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|