C17H25FN2O2 — CID 132650363
2-[butanoyl-[(4-fluorophenyl)methyl]amino]-N-ethylbutanamide (PubChem CID 132650363) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[butanoyl-[(4-fluorophenyl)methyl]amino]-N-ethylbutanamide.
| Compound Name | 2-[butanoyl-[(4-fluorophenyl)methyl]amino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 132650363 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-[butanoyl-[(4-fluorophenyl)methyl]amino]-N-ethylbutanamide |
| SMILES | CCCC(=O)N(Cc1ccc(F)cc1)C(CC)C(=O)NCC |
| InChI | InChI=1S/C17H25FN2O2/c1-4-7-16(21)20(15(5-2)17(22)19-6-3)12-13-8-10-14(18)11-9-13/h8-11,15H,4-7,12H2,1-3H3,(H,19,22) |
| InChIKey | XKOFQKPRDRHFRY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |