C27H37FN2O2 — CID 132672138
2-[3-(4-tert-butylphenyl)propanoyl-[(4-fluorophenyl)methyl]amino]-N-propylbutanamide (PubChem CID 132672138) has the molecular formula C27H37FN2O2 and a molecular weight of 440.60 g/mol. Its IUPAC name is 2-[3-(4-tert-butylphenyl)propanoyl-[(4-fluorophenyl)methyl]amino]-N-propylbutanamide.
| Compound Name | 2-[3-(4-tert-butylphenyl)propanoyl-[(4-fluorophenyl)methyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132672138 |
| Molecular Formula | C27H37FN2O2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-[3-(4-tert-butylphenyl)propanoyl-[(4-fluorophenyl)methyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccc(F)cc1)C(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H37FN2O2/c1-6-18-29-26(32)24(7-2)30(19-21-10-15-23(28)16-11-21)25(31)17-12-20-8-13-22(14-9-20)27(3,4)5/h8-11,13-16,24H,6-7,12,17-19H2,1-5H3,(H,29,32) |
| InChIKey | WHRAUNBSPFKIOT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |