C26H35FN2O2 — CID 132668005
2-[3-(4-tert-butylphenyl)propanoyl-[(4-fluorophenyl)methyl]amino]-N-propylpropanamide (PubChem CID 132668005) has the molecular formula C26H35FN2O2 and a molecular weight of 426.58 g/mol. Its IUPAC name is 2-[3-(4-tert-butylphenyl)propanoyl-[(4-fluorophenyl)methyl]amino]-N-propylpropanamide.
| Compound Name | 2-[3-(4-tert-butylphenyl)propanoyl-[(4-fluorophenyl)methyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 132668005 |
| Molecular Formula | C26H35FN2O2 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 2-[3-(4-tert-butylphenyl)propanoyl-[(4-fluorophenyl)methyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)N(Cc1ccc(F)cc1)C(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H35FN2O2/c1-6-17-28-25(31)19(2)29(18-21-9-14-23(27)15-10-21)24(30)16-11-20-7-12-22(13-8-20)26(3,4)5/h7-10,12-15,19H,6,11,16-18H2,1-5H3,(H,28,31) |
| InChIKey | WGABSLXCKPTQRK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |