C24H27NO — CID 132652663
N-[1-(3,4-dimethylphenyl)propyl]-3-naphthalen-1-ylpropanamide (PubChem CID 132652663) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)propyl]-3-naphthalen-1-ylpropanamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)propyl]-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 132652663 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)propyl]-3-naphthalen-1-ylpropanamide |
| SMILES | CCC(NC(=O)CCc1cccc2ccccc12)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H27NO/c1-4-23(21-13-12-17(2)18(3)16-21)25-24(26)15-14-20-10-7-9-19-8-5-6-11-22(19)20/h5-13,16,23H,4,14-15H2,1-3H3,(H,25,26) |
| InChIKey | UWYTWGBAPFYGKA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |