C21H25NO4 — CID 132653607
ethyl 4-[2-(2,4-dimethylphenoxy)propanoylamino]-3-methylbenzoate (PubChem CID 132653607) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is ethyl 4-[2-(2,4-dimethylphenoxy)propanoylamino]-3-methylbenzoate.
| Compound Name | ethyl 4-[2-(2,4-dimethylphenoxy)propanoylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 132653607 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | ethyl 4-[2-(2,4-dimethylphenoxy)propanoylamino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)Oc2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H25NO4/c1-6-25-21(24)17-8-9-18(14(3)12-17)22-20(23)16(5)26-19-10-7-13(2)11-15(19)4/h7-12,16H,6H2,1-5H3,(H,22,23) |
| InChIKey | DSRFELLFRBURDP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |