C22H27NO4 — CID 28569462
ethyl 4-[[(2S)-2-(2,5-dimethylphenoxy)butanoyl]amino]-3-methylbenzoate (PubChem CID 28569462) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethyl 4-[[(2S)-2-(2,5-dimethylphenoxy)butanoyl]amino]-3-methylbenzoate.
| Compound Name | ethyl 4-[[(2S)-2-(2,5-dimethylphenoxy)butanoyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 28569462 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethyl 4-[[(2S)-2-(2,5-dimethylphenoxy)butanoyl]amino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](CC)Oc2cc(C)ccc2C)c(C)c1 |
| InChI | InChI=1S/C22H27NO4/c1-6-19(27-20-12-14(3)8-9-15(20)4)21(24)23-18-11-10-17(13-16(18)5)22(25)26-7-2/h8-13,19H,6-7H2,1-5H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | XTSUMRNQFHJESP-IBGZPJMESA-N |
| XLogP | 4.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |