C19H22N2O3 — CID 94020116
2-[[(2R)-2-(2,5-dimethylphenoxy)butanoyl]amino]benzamide (PubChem CID 94020116) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[[(2R)-2-(2,5-dimethylphenoxy)butanoyl]amino]benzamide.
| Compound Name | 2-[[(2R)-2-(2,5-dimethylphenoxy)butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 94020116 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-[[(2R)-2-(2,5-dimethylphenoxy)butanoyl]amino]benzamide |
| SMILES | CC[C@@H](Oc1cc(C)ccc1C)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C19H22N2O3/c1-4-16(24-17-11-12(2)9-10-13(17)3)19(23)21-15-8-6-5-7-14(15)18(20)22/h5-11,16H,4H2,1-3H3,(H2,20,22)(H,21,23)/t16-/m1/s1 |
| InChIKey | WQQDKDAWFZLLLL-MRXNPFEDSA-N |
| XLogP | 3.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |