C18H20N2O4 — CID 99132395
2-[[(2R)-2-(2-methoxyphenoxy)butanoyl]amino]benzamide (PubChem CID 99132395) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[[(2R)-2-(2-methoxyphenoxy)butanoyl]amino]benzamide.
| Compound Name | 2-[[(2R)-2-(2-methoxyphenoxy)butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 99132395 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-[[(2R)-2-(2-methoxyphenoxy)butanoyl]amino]benzamide |
| SMILES | CC[C@@H](Oc1ccccc1OC)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C18H20N2O4/c1-3-14(24-16-11-7-6-10-15(16)23-2)18(22)20-13-9-5-4-8-12(13)17(19)21/h4-11,14H,3H2,1-2H3,(H2,19,21)(H,20,22)/t14-/m1/s1 |
| InChIKey | LKSBTMYDSGKUTM-CQSZACIVSA-N |
| XLogP | 2.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |