C20H19N5O2 — CID 132654360
4-[[4-[3-(4-methoxyphenyl)-1,3-oxazolidin-2-yl]triazol-1-yl]methyl]benzonitrile (PubChem CID 132654360) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-[[4-[3-(4-methoxyphenyl)-1,3-oxazolidin-2-yl]triazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[3-(4-methoxyphenyl)-1,3-oxazolidin-2-yl]triazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 132654360 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-[[4-[3-(4-methoxyphenyl)-1,3-oxazolidin-2-yl]triazol-1-yl]methyl]benzonitrile |
| SMILES | COc1ccc(N2CCOC2c2cn(Cc3ccc(C#N)cc3)nn2)cc1 |
| InChI | InChI=1S/C20H19N5O2/c1-26-18-8-6-17(7-9-18)25-10-11-27-20(25)19-14-24(23-22-19)13-16-4-2-15(12-21)3-5-16/h2-9,14,20H,10-11,13H2,1H3 |
| InChIKey | ZCODHCUDXODSIN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 76.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|