C20H21ClN4O — CID 132655335
2-[1-[(4-chlorophenyl)methyl]triazol-4-yl]-3-(4-ethylphenyl)-1,3-oxazolidine (PubChem CID 132655335) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]triazol-4-yl]-3-(4-ethylphenyl)-1,3-oxazolidine.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]triazol-4-yl]-3-(4-ethylphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 132655335 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]triazol-4-yl]-3-(4-ethylphenyl)-1,3-oxazolidine |
| SMILES | CCc1ccc(N2CCOC2c2cn(Cc3ccc(Cl)cc3)nn2)cc1 |
| InChI | InChI=1S/C20H21ClN4O/c1-2-15-5-9-18(10-6-15)25-11-12-26-20(25)19-14-24(23-22-19)13-16-3-7-17(21)8-4-16/h3-10,14,20H,2,11-13H2,1H3 |
| InChIKey | ISDQPUNVVPRBAC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|