C20H21BrN4O — CID 99966524
(2S)-2-[1-[(3-bromophenyl)methyl]triazol-4-yl]-3-(4-ethylphenyl)-1,3-oxazolidine (PubChem CID 99966524) has the molecular formula C20H21BrN4O and a molecular weight of 413.32 g/mol. Its IUPAC name is (2S)-2-[1-[(3-bromophenyl)methyl]triazol-4-yl]-3-(4-ethylphenyl)-1,3-oxazolidine.
| Compound Name | (2S)-2-[1-[(3-bromophenyl)methyl]triazol-4-yl]-3-(4-ethylphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 99966524 |
| Molecular Formula | C20H21BrN4O |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (2S)-2-[1-[(3-bromophenyl)methyl]triazol-4-yl]-3-(4-ethylphenyl)-1,3-oxazolidine |
| SMILES | CCc1ccc(N2CCO[C@H]2c2cn(Cc3cccc(Br)c3)nn2)cc1 |
| InChI | InChI=1S/C20H21BrN4O/c1-2-15-6-8-18(9-7-15)25-10-11-26-20(25)19-14-24(23-22-19)13-16-4-3-5-17(21)12-16/h3-9,12,14,20H,2,10-11,13H2,1H3/t20-/m0/s1 |
| InChIKey | ZYUKXDJVTQVBLL-FQEVSTJZSA-N |
| XLogP | 4.19 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|