C20H19F3N4O — CID 132658698
3-(4-methylphenyl)-2-[1-[[3-(trifluoromethyl)phenyl]methyl]triazol-4-yl]-1,3-oxazolidine (PubChem CID 132658698) has the molecular formula C20H19F3N4O and a molecular weight of 388.39 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-[1-[[3-(trifluoromethyl)phenyl]methyl]triazol-4-yl]-1,3-oxazolidine.
| Compound Name | 3-(4-methylphenyl)-2-[1-[[3-(trifluoromethyl)phenyl]methyl]triazol-4-yl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 132658698 |
| Molecular Formula | C20H19F3N4O |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-(4-methylphenyl)-2-[1-[[3-(trifluoromethyl)phenyl]methyl]triazol-4-yl]-1,3-oxazolidine |
| SMILES | Cc1ccc(N2CCOC2c2cn(Cc3cccc(C(F)(F)F)c3)nn2)cc1 |
| InChI | InChI=1S/C20H19F3N4O/c1-14-5-7-17(8-6-14)27-9-10-28-19(27)18-13-26(25-24-18)12-15-3-2-4-16(11-15)20(21,22)23/h2-8,11,13,19H,9-10,12H2,1H3 |
| InChIKey | TXTYVHQONGHIKF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|