C21H21F3N4O — CID 132661621
3-(4-ethylphenyl)-2-[1-[[3-(trifluoromethyl)phenyl]methyl]triazol-4-yl]-1,3-oxazolidine (PubChem CID 132661621) has the molecular formula C21H21F3N4O and a molecular weight of 402.42 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-2-[1-[[3-(trifluoromethyl)phenyl]methyl]triazol-4-yl]-1,3-oxazolidine.
| Compound Name | 3-(4-ethylphenyl)-2-[1-[[3-(trifluoromethyl)phenyl]methyl]triazol-4-yl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 132661621 |
| Molecular Formula | C21H21F3N4O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-(4-ethylphenyl)-2-[1-[[3-(trifluoromethyl)phenyl]methyl]triazol-4-yl]-1,3-oxazolidine |
| SMILES | CCc1ccc(N2CCOC2c2cn(Cc3cccc(C(F)(F)F)c3)nn2)cc1 |
| InChI | InChI=1S/C21H21F3N4O/c1-2-15-6-8-18(9-7-15)28-10-11-29-20(28)19-14-27(26-25-19)13-16-4-3-5-17(12-16)21(22,23)24/h3-9,12,14,20H,2,10-11,13H2,1H3 |
| InChIKey | LSAFSORKVUEWDZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|