C19H19ClN4O — CID 99966302
(2R)-2-[1-[(2-chlorophenyl)methyl]triazol-4-yl]-3-(4-methylphenyl)-1,3-oxazolidine (PubChem CID 99966302) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is (2R)-2-[1-[(2-chlorophenyl)methyl]triazol-4-yl]-3-(4-methylphenyl)-1,3-oxazolidine.
| Compound Name | (2R)-2-[1-[(2-chlorophenyl)methyl]triazol-4-yl]-3-(4-methylphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 99966302 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2R)-2-[1-[(2-chlorophenyl)methyl]triazol-4-yl]-3-(4-methylphenyl)-1,3-oxazolidine |
| SMILES | Cc1ccc(N2CCO[C@@H]2c2cn(Cc3ccccc3Cl)nn2)cc1 |
| InChI | InChI=1S/C19H19ClN4O/c1-14-6-8-16(9-7-14)24-10-11-25-19(24)18-13-23(22-21-18)12-15-4-2-3-5-17(15)20/h2-9,13,19H,10-12H2,1H3/t19-/m1/s1 |
| InChIKey | SPELYEQRLNYQEM-LJQANCHMSA-N |
| XLogP | 3.82 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|