C22H24N4O3 — CID 99966518
methyl 3-[[4-[(2S)-3-(4-ethylphenyl)-1,3-oxazolidin-2-yl]triazol-1-yl]methyl]benzoate (PubChem CID 99966518) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is methyl 3-[[4-[(2S)-3-(4-ethylphenyl)-1,3-oxazolidin-2-yl]triazol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[4-[(2S)-3-(4-ethylphenyl)-1,3-oxazolidin-2-yl]triazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 99966518 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | methyl 3-[[4-[(2S)-3-(4-ethylphenyl)-1,3-oxazolidin-2-yl]triazol-1-yl]methyl]benzoate |
| SMILES | CCc1ccc(N2CCO[C@H]2c2cn(Cc3cccc(C(=O)OC)c3)nn2)cc1 |
| InChI | InChI=1S/C22H24N4O3/c1-3-16-7-9-19(10-8-16)26-11-12-29-21(26)20-15-25(24-23-20)14-17-5-4-6-18(13-17)22(27)28-2/h4-10,13,15,21H,3,11-12,14H2,1-2H3/t21-/m0/s1 |
| InChIKey | LTYFYQBOBXOLHL-NRFANRHFSA-N |
| XLogP | 3.21 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|