C22H21F3N2O — CID 132658247
3-(4-ethylphenyl)-2-[1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1,3-oxazolidine (PubChem CID 132658247) has the molecular formula C22H21F3N2O and a molecular weight of 386.42 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-2-[1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1,3-oxazolidine.
| Compound Name | 3-(4-ethylphenyl)-2-[1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 132658247 |
| Molecular Formula | C22H21F3N2O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-(4-ethylphenyl)-2-[1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1,3-oxazolidine |
| SMILES | CCc1ccc(N2CCOC2c2ccn(-c3ccccc3C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H21F3N2O/c1-2-16-7-9-18(10-8-16)27-13-14-28-21(27)17-11-12-26(15-17)20-6-4-3-5-19(20)22(23,24)25/h3-12,15,21H,2,13-14H2,1H3 |
| InChIKey | SJBJGJGMQRIPIU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|