C21H19F3N2O2 — CID 99965538
(2S)-3-(4-methoxyphenyl)-2-[1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1,3-oxazolidine (PubChem CID 99965538) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is (2S)-3-(4-methoxyphenyl)-2-[1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1,3-oxazolidine.
| Compound Name | (2S)-3-(4-methoxyphenyl)-2-[1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 99965538 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2S)-3-(4-methoxyphenyl)-2-[1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1,3-oxazolidine |
| SMILES | COc1ccc(N2CCO[C@H]2c2ccn(-c3ccccc3C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-27-17-8-6-16(7-9-17)26-12-13-28-20(26)15-10-11-25(14-15)19-5-3-2-4-18(19)21(22,23)24/h2-11,14,20H,12-13H2,1H3/t20-/m0/s1 |
| InChIKey | FBRIPAZDKJJZOF-FQEVSTJZSA-N |
| XLogP | 5.04 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|