C20H19ClN2O2 — CID 99965492
(2R)-2-[1-(4-chlorophenyl)pyrrol-3-yl]-3-(4-methoxyphenyl)-1,3-oxazolidine (PubChem CID 99965492) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (2R)-2-[1-(4-chlorophenyl)pyrrol-3-yl]-3-(4-methoxyphenyl)-1,3-oxazolidine.
| Compound Name | (2R)-2-[1-(4-chlorophenyl)pyrrol-3-yl]-3-(4-methoxyphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 99965492 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (2R)-2-[1-(4-chlorophenyl)pyrrol-3-yl]-3-(4-methoxyphenyl)-1,3-oxazolidine |
| SMILES | COc1ccc(N2CCO[C@@H]2c2ccn(-c3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-24-19-8-6-18(7-9-19)23-12-13-25-20(23)15-10-11-22(14-15)17-4-2-16(21)3-5-17/h2-11,14,20H,12-13H2,1H3/t20-/m1/s1 |
| InChIKey | XZTRKRYWNYEORT-HXUWFJFHSA-N |
| XLogP | 4.67 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|