C20H19BrN2O — CID 99965257
(2S)-2-[1-(4-bromophenyl)pyrrol-3-yl]-3-(4-methylphenyl)-1,3-oxazolidine (PubChem CID 99965257) has the molecular formula C20H19BrN2O and a molecular weight of 383.29 g/mol. Its IUPAC name is (2S)-2-[1-(4-bromophenyl)pyrrol-3-yl]-3-(4-methylphenyl)-1,3-oxazolidine.
| Compound Name | (2S)-2-[1-(4-bromophenyl)pyrrol-3-yl]-3-(4-methylphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 99965257 |
| Molecular Formula | C20H19BrN2O |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (2S)-2-[1-(4-bromophenyl)pyrrol-3-yl]-3-(4-methylphenyl)-1,3-oxazolidine |
| SMILES | Cc1ccc(N2CCO[C@H]2c2ccn(-c3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C20H19BrN2O/c1-15-2-6-19(7-3-15)23-12-13-24-20(23)16-10-11-22(14-16)18-8-4-17(21)5-9-18/h2-11,14,20H,12-13H2,1H3/t20-/m0/s1 |
| InChIKey | MYVBSXCVWYYEBP-FQEVSTJZSA-N |
| XLogP | 5.08 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|