C22H24N2O2 — CID 99965262
(2S)-2-[1-(4-ethoxyphenyl)pyrrol-3-yl]-3-(4-methylphenyl)-1,3-oxazolidine (PubChem CID 99965262) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (2S)-2-[1-(4-ethoxyphenyl)pyrrol-3-yl]-3-(4-methylphenyl)-1,3-oxazolidine.
| Compound Name | (2S)-2-[1-(4-ethoxyphenyl)pyrrol-3-yl]-3-(4-methylphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 99965262 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2S)-2-[1-(4-ethoxyphenyl)pyrrol-3-yl]-3-(4-methylphenyl)-1,3-oxazolidine |
| SMILES | CCOc1ccc(-n2ccc([C@@H]3OCCN3c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-25-21-10-8-19(9-11-21)23-13-12-18(16-23)22-24(14-15-26-22)20-6-4-17(2)5-7-20/h4-13,16,22H,3,14-15H2,1-2H3/t22-/m0/s1 |
| InChIKey | PAAZGFWBKFMJFT-QFIPXVFZSA-N |
| XLogP | 4.72 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|