C15H12Cl2F2N2O3S — CID 1326607
2-(2,5-dichloro-N-methylsulfonylanilino)-N-(2,4-difluorophenyl)acetamide (PubChem CID 1326607) has the molecular formula C15H12Cl2F2N2O3S and a molecular weight of 409.24 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-methylsulfonylanilino)-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 1326607 |
| Molecular Formula | C15H12Cl2F2N2O3S |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-(2,4-difluorophenyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(F)cc1F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2F2N2O3S/c1-25(23,24)21(14-6-9(16)2-4-11(14)17)8-15(22)20-13-5-3-10(18)7-12(13)19/h2-7H,8H2,1H3,(H,20,22) |
| InChIKey | GIGVAJYEJKRYGN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |