C16H15NS — CID 13266209
(E)-2-methyl-N,3-diphenylprop-2-enethioamide (PubChem CID 13266209) has the molecular formula C16H15NS and a molecular weight of 253.37 g/mol. Its IUPAC name is (E)-2-methyl-N,3-diphenylprop-2-enethioamide.
| Compound Name | (E)-2-methyl-N,3-diphenylprop-2-enethioamide |
|---|---|
| PubChem CID | 13266209 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (E)-2-methyl-N,3-diphenylprop-2-enethioamide |
| SMILES | C/C(=C\c1ccccc1)C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C16H15NS/c1-13(12-14-8-4-2-5-9-14)16(18)17-15-10-6-3-7-11-15/h2-12H,1H3,(H,17,18)/b13-12+ |
| InChIKey | FQEHGAMYEBUYDF-OUKQBFOZSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|