C22H26ClNO2S — CID 132662172
4-(4-chlorophenyl)sulfanyl-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)butanamide (PubChem CID 132662172) has the molecular formula C22H26ClNO2S and a molecular weight of 403.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)butanamide |
|---|---|
| PubChem CID | 132662172 |
| Molecular Formula | C22H26ClNO2S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)butanamide |
| SMILES | Cc1ccc2c(c1)OC(C)(C)CC2NC(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26ClNO2S/c1-15-6-11-18-19(14-22(2,3)26-20(18)13-15)24-21(25)5-4-12-27-17-9-7-16(23)8-10-17/h6-11,13,19H,4-5,12,14H2,1-3H3,(H,24,25) |
| InChIKey | JFQBUWMFQNWDBB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|