C21H28N2O4S — CID 132662390
N-benzyl-2-(4-ethoxy-N-methylsulfonylanilino)-N-methylbutanamide (PubChem CID 132662390) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is N-benzyl-2-(4-ethoxy-N-methylsulfonylanilino)-N-methylbutanamide.
| Compound Name | N-benzyl-2-(4-ethoxy-N-methylsulfonylanilino)-N-methylbutanamide |
|---|---|
| PubChem CID | 132662390 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-benzyl-2-(4-ethoxy-N-methylsulfonylanilino)-N-methylbutanamide |
| SMILES | CCOc1ccc(N(C(CC)C(=O)N(C)Cc2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H28N2O4S/c1-5-20(21(24)22(3)16-17-10-8-7-9-11-17)23(28(4,25)26)18-12-14-19(15-13-18)27-6-2/h7-15,20H,5-6,16H2,1-4H3 |
| InChIKey | ZETDHFHURLAHDJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |