C20H25ClN2O3S — CID 132663427
N-benzyl-2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-methylbutanamide (PubChem CID 132663427) has the molecular formula C20H25ClN2O3S and a molecular weight of 408.95 g/mol. Its IUPAC name is N-benzyl-2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-methylbutanamide.
| Compound Name | N-benzyl-2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-methylbutanamide |
|---|---|
| PubChem CID | 132663427 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-benzyl-2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-methylbutanamide |
| SMILES | CCC(C(=O)N(C)Cc1ccccc1)N(c1ccc(C)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C20H25ClN2O3S/c1-5-19(20(24)22(3)14-16-9-7-6-8-10-16)23(27(4,25)26)17-12-11-15(2)18(21)13-17/h6-13,19H,5,14H2,1-4H3 |
| InChIKey | JKENJPQOILKUGB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |