C22H29ClN2O3S — CID 132671099
2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(4-phenylbutan-2-yl)butanamide (PubChem CID 132671099) has the molecular formula C22H29ClN2O3S and a molecular weight of 437.01 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(4-phenylbutan-2-yl)butanamide.
| Compound Name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(4-phenylbutan-2-yl)butanamide |
|---|---|
| PubChem CID | 132671099 |
| Molecular Formula | C22H29ClN2O3S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(4-phenylbutan-2-yl)butanamide |
| SMILES | CCC(C(=O)NC(C)CCc1ccccc1)N(c1ccc(C)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C22H29ClN2O3S/c1-5-21(22(26)24-17(3)12-13-18-9-7-6-8-10-18)25(29(4,27)28)19-14-11-16(2)20(23)15-19/h6-11,14-15,17,21H,5,12-13H2,1-4H3,(H,24,26) |
| InChIKey | DHAVMMJPTGLWAR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |