C17H17F2N3O6S — CID 132668718
2-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 132668718) has the molecular formula C17H17F2N3O6S and a molecular weight of 429.40 g/mol. Its IUPAC name is 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 132668718 |
| Molecular Formula | C17H17F2N3O6S |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)N(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H17F2N3O6S/c1-10(21(29(3,26)27)11-4-6-13(18)14(19)8-11)17(23)20-15-9-12(22(24)25)5-7-16(15)28-2/h4-10H,1-3H3,(H,20,23) |
| InChIKey | NOOIWGYQWCJIRB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|