C16H14ClF2N3O5S — CID 132670055
N-(2-chloro-5-nitrophenyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide (PubChem CID 132670055) has the molecular formula C16H14ClF2N3O5S and a molecular weight of 433.82 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 132670055 |
| Molecular Formula | C16H14ClF2N3O5S |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
| SMILES | CC(C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)N(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C16H14ClF2N3O5S/c1-9(16(23)20-15-8-11(22(24)25)3-5-12(15)17)21(28(2,26)27)10-4-6-13(18)14(19)7-10/h3-9H,1-2H3,(H,20,23) |
| InChIKey | OTIBHCXLSXUAEM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|